C22H35N3O2 — CID 166926233
tert-butyl N-[1-[1-[4-(1-aminocyclopropyl)phenyl]propyl]piperidin-4-yl]carbamate (PubChem CID 166926233) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is tert-butyl N-[1-[1-[4-(1-aminocyclopropyl)phenyl]propyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-[4-(1-aminocyclopropyl)phenyl]propyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 166926233 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | tert-butyl N-[1-[1-[4-(1-aminocyclopropyl)phenyl]propyl]piperidin-4-yl]carbamate |
| SMILES | CCC(c1ccc(C2(N)CC2)cc1)N1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H35N3O2/c1-5-19(16-6-8-17(9-7-16)22(23)12-13-22)25-14-10-18(11-15-25)24-20(26)27-21(2,3)4/h6-9,18-19H,5,10-15,23H2,1-4H3,(H,24,26) |
| InChIKey | REEOPMFVYWFBRH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |