C33H36ClNO2 — CID 166926980
2-[4-[3-[4-(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)piperidin-1-yl]propyl]phenyl]-2-methylpropanoic acid (PubChem CID 166926980) has the molecular formula C33H36ClNO2 and a molecular weight of 514.11 g/mol. Its IUPAC name is 2-[4-[3-[4-(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)piperidin-1-yl]propyl]phenyl]-2-methylpropanoic acid.
| Compound Name | 2-[4-[3-[4-(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)piperidin-1-yl]propyl]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 166926980 |
| Molecular Formula | C33H36ClNO2 |
| Molecular Weight | 514.11 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 2-[4-[3-[4-(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)piperidin-1-yl]propyl]phenyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1ccc(CCCN2CCC(=C3c4ccccc4CCc4cc(Cl)ccc43)CC2)cc1 |
| InChI | InChI=1S/C33H36ClNO2/c1-33(2,32(36)37)27-13-9-23(10-14-27)6-5-19-35-20-17-25(18-21-35)31-29-8-4-3-7-24(29)11-12-26-22-28(34)15-16-30(26)31/h3-4,7-10,13-16,22H,5-6,11-12,17-21H2,1-2H3,(H,36,37) |
| InChIKey | GPBLOFHYNHXOML-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.11 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|