C13H19F2NO — CID 166927491
N-[(2E)-2,5-dimethylhexa-2,4-dienyl]-3,3-difluorocyclobutane-1-carboxamide (PubChem CID 166927491) has the molecular formula C13H19F2NO and a molecular weight of 243.30 g/mol. Its IUPAC name is N-[(2E)-2,5-dimethylhexa-2,4-dienyl]-3,3-difluorocyclobutane-1-carboxamide.
| Compound Name | N-[(2E)-2,5-dimethylhexa-2,4-dienyl]-3,3-difluorocyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 166927491 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-[(2E)-2,5-dimethylhexa-2,4-dienyl]-3,3-difluorocyclobutane-1-carboxamide |
| SMILES | CC(C)=C/C=C(\C)CNC(=O)C1CC(F)(F)C1 |
| InChI | InChI=1S/C13H19F2NO/c1-9(2)4-5-10(3)8-16-12(17)11-6-13(14,15)7-11/h4-5,11H,6-8H2,1-3H3,(H,16,17)/b10-5+ |
| InChIKey | YFOOIAGKGMTHGB-BJMVGYQFSA-N |
| XLogP | 3.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|