C25H35N — CID 166927538
N-[(4E,6Z)-2-[6-(3-methylhept-4-en-3-yl)cyclohexa-1,3-dien-1-yl]nona-1,4,6,8-tetraen-4-yl]ethanimine (PubChem CID 166927538) has the molecular formula C25H35N and a molecular weight of 349.56 g/mol. Its IUPAC name is N-[(4E,6Z)-2-[6-(3-methylhept-4-en-3-yl)cyclohexa-1,3-dien-1-yl]nona-1,4,6,8-tetraen-4-yl]ethanimine.
| Compound Name | N-[(4E,6Z)-2-[6-(3-methylhept-4-en-3-yl)cyclohexa-1,3-dien-1-yl]nona-1,4,6,8-tetraen-4-yl]ethanimine |
|---|---|
| PubChem CID | 166927538 |
| Molecular Formula | C25H35N |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.28 |
| IUPAC Name | N-[(4E,6Z)-2-[6-(3-methylhept-4-en-3-yl)cyclohexa-1,3-dien-1-yl]nona-1,4,6,8-tetraen-4-yl]ethanimine |
| SMILES | C=C/C=C\C=C(CC(=C)C1=CC=CCC1C(C)(C=CCC)CC)\N=C\C |
| InChI | InChI=1S/C25H35N/c1-7-11-13-16-22(26-10-4)20-21(5)23-17-14-15-18-24(23)25(6,9-3)19-12-8-2/h7,10-17,19,24H,1,5,8-9,18,20H2,2-4,6H3/b13-11-,19-12?,22-16+,26-10+ |
| InChIKey | LYXXOYHORZURDX-ORYFXUOBSA-N |
| XLogP | 7.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|