About (1E)-1-hydrazinyl-N-methyl-N-phosphanylbuta-1,3-dien-2-amine
(1E)-1-hydrazinyl-N-methyl-N-phosphanylbuta-1,3-dien-2-amine (PubChem CID 166928188) has the molecular formula C5H12N3P
and a molecular weight of 145.15 g/mol. Its IUPAC name is (1E)-1-hydrazinyl-N-methyl-N-phosphanylbuta-1,3-dien-2-amine.
Molecular Properties
| Compound Name | (1E)-1-hydrazinyl-N-methyl-N-phosphanylbuta-1,3-dien-2-amine |
| PubChem CID | 166928188 |
| Molecular Formula | C5H12N3P |
| Molecular Weight | 145.15 g/mol |
| Exact Mass | 145.08 |
| IUPAC Name | (1E)-1-hydrazinyl-N-methyl-N-phosphanylbuta-1,3-dien-2-amine |
| SMILES | C=C/C(=C\NN)N(C)P |
| InChI | InChI=1S/C5H12N3P/c1-3-5(4-7-6)8(2)9/h3-4,7H,1,6,9H2,2H3/b5-4+ |
| InChIKey | COBRFDAFKLVLOQ-SNAWJCMRSA-N |
| XLogP | 0.20 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.15 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-hydrazinyl-N-methyl-N-phosphanylbuta-1,3-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-hydrazinyl-N-methyl-N-phosphanylbuta-1,3-dien-2-amine?
The IUPAC name of (1E)-1-hydrazinyl-N-methyl-N-phosphanylbuta-1,3-dien-2-amine (CID 166928188) is (1E)-1-hydrazinyl-N-methyl-N-phosphanylbuta-1,3-dien-2-amine.
What is the SMILES notation for (1E)-1-hydrazinyl-N-methyl-N-phosphanylbuta-1,3-dien-2-amine?
The canonical SMILES for (1E)-1-hydrazinyl-N-methyl-N-phosphanylbuta-1,3-dien-2-amine is C=C/C(=C\NN)N(C)P.
What is the InChIKey of (1E)-1-hydrazinyl-N-methyl-N-phosphanylbuta-1,3-dien-2-amine?
The InChIKey is COBRFDAFKLVLOQ-SNAWJCMRSA-N. The full InChI is InChI=1S/C5H12N3P/c1-3-5(4-7-6)8(2)9/h3-4,7H,1,6,9H2,2H3/b5-4+.
What are the key properties of (1E)-1-hydrazinyl-N-methyl-N-phosphanylbuta-1,3-dien-2-amine?
(1E)-1-hydrazinyl-N-methyl-N-phosphanylbuta-1,3-dien-2-amine has a molecular weight of 145.15 g/mol, XLogP of 0.20, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-hydrazinyl-N-methyl-N-phosphanylbuta-1,3-dien-2-amine is sourced from PubChem (CID 166928188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).