About 5,7-di(propan-2-yl)thieno[2,3-c]pyridine
5,7-di(propan-2-yl)thieno[2,3-c]pyridine (PubChem CID 166928796) has the molecular formula C13H17NS
and a molecular weight of 219.35 g/mol. Its IUPAC name is 5,7-di(propan-2-yl)thieno[2,3-c]pyridine.
Molecular Properties
| Compound Name | 5,7-di(propan-2-yl)thieno[2,3-c]pyridine |
| PubChem CID | 166928796 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 5,7-di(propan-2-yl)thieno[2,3-c]pyridine |
| SMILES | CC(C)c1cc2ccsc2c(C(C)C)n1 |
| InChI | InChI=1S/C13H17NS/c1-8(2)11-7-10-5-6-15-13(10)12(14-11)9(3)4/h5-9H,1-4H3 |
| InChIKey | UJTJOHWWFDJJSM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-di(propan-2-yl)thieno[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-di(propan-2-yl)thieno[2,3-c]pyridine?
The IUPAC name of 5,7-di(propan-2-yl)thieno[2,3-c]pyridine (CID 166928796) is 5,7-di(propan-2-yl)thieno[2,3-c]pyridine.
What is the SMILES notation for 5,7-di(propan-2-yl)thieno[2,3-c]pyridine?
The canonical SMILES for 5,7-di(propan-2-yl)thieno[2,3-c]pyridine is CC(C)c1cc2ccsc2c(C(C)C)n1.
What is the InChIKey of 5,7-di(propan-2-yl)thieno[2,3-c]pyridine?
The InChIKey is UJTJOHWWFDJJSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NS/c1-8(2)11-7-10-5-6-15-13(10)12(14-11)9(3)4/h5-9H,1-4H3.
What are the key properties of 5,7-di(propan-2-yl)thieno[2,3-c]pyridine?
5,7-di(propan-2-yl)thieno[2,3-c]pyridine has a molecular weight of 219.35 g/mol, XLogP of 4.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-di(propan-2-yl)thieno[2,3-c]pyridine is sourced from PubChem (CID 166928796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).