C15H20FNO — CID 166929113
(2R,8S)-2-fluoro-8-(phenylmethoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 166929113) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is (2R,8S)-2-fluoro-8-(phenylmethoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | (2R,8S)-2-fluoro-8-(phenylmethoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 166929113 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (2R,8S)-2-fluoro-8-(phenylmethoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | F[C@H]1CN2CCC[C@@]2(COCc2ccccc2)C1 |
| InChI | InChI=1S/C15H20FNO/c16-14-9-15(7-4-8-17(15)10-14)12-18-11-13-5-2-1-3-6-13/h1-3,5-6,14H,4,7-12H2/t14-,15+/m1/s1 |
| InChIKey | XERGYQQEOYPZLV-CABCVRRESA-N |
| XLogP | 2.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |