About 1-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N'-methylmethanediamine
1-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N'-methylmethanediamine (PubChem CID 166929131) has the molecular formula C8H18N4
and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N'-methylmethanediamine.
Molecular Properties
| Compound Name | 1-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N'-methylmethanediamine |
| PubChem CID | 166929131 |
| Molecular Formula | C8H18N4 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | 1-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N'-methylmethanediamine |
| SMILES | CNC(N)N1C2CCC1CNC2 |
| InChI | InChI=1S/C8H18N4/c1-10-8(9)12-6-2-3-7(12)5-11-4-6/h6-8,10-11H,2-5,9H2,1H3 |
| InChIKey | VWFKGOUBBWADEU-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N'-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N'-methylmethanediamine?
The IUPAC name of 1-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N'-methylmethanediamine (CID 166929131) is 1-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N'-methylmethanediamine.
What is the SMILES notation for 1-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N'-methylmethanediamine?
The canonical SMILES for 1-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N'-methylmethanediamine is CNC(N)N1C2CCC1CNC2.
What is the InChIKey of 1-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N'-methylmethanediamine?
The InChIKey is VWFKGOUBBWADEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4/c1-10-8(9)12-6-2-3-7(12)5-11-4-6/h6-8,10-11H,2-5,9H2,1H3.
What are the key properties of 1-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N'-methylmethanediamine?
1-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N'-methylmethanediamine has a molecular weight of 170.26 g/mol, XLogP of -1.12, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N'-methylmethanediamine is sourced from PubChem (CID 166929131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).