About (5R)-3,3-difluoro-5-(methoxymethyl)-1-methylpiperidine
(5R)-3,3-difluoro-5-(methoxymethyl)-1-methylpiperidine (PubChem CID 166929234) has the molecular formula C8H15F2NO
and a molecular weight of 179.21 g/mol. Its IUPAC name is (5R)-3,3-difluoro-5-(methoxymethyl)-1-methylpiperidine.
Molecular Properties
| Compound Name | (5R)-3,3-difluoro-5-(methoxymethyl)-1-methylpiperidine |
| PubChem CID | 166929234 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (5R)-3,3-difluoro-5-(methoxymethyl)-1-methylpiperidine |
| SMILES | COC[C@H]1CN(C)CC(F)(F)C1 |
| InChI | InChI=1S/C8H15F2NO/c1-11-4-7(5-12-2)3-8(9,10)6-11/h7H,3-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | LINOWXUJFNLRGE-SSDOTTSWSA-N |
| XLogP | 1.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-3,3-difluoro-5-(methoxymethyl)-1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3,3-difluoro-5-(methoxymethyl)-1-methylpiperidine?
The IUPAC name of (5R)-3,3-difluoro-5-(methoxymethyl)-1-methylpiperidine (CID 166929234) is (5R)-3,3-difluoro-5-(methoxymethyl)-1-methylpiperidine.
What is the SMILES notation for (5R)-3,3-difluoro-5-(methoxymethyl)-1-methylpiperidine?
The canonical SMILES for (5R)-3,3-difluoro-5-(methoxymethyl)-1-methylpiperidine is COC[C@H]1CN(C)CC(F)(F)C1.
What is the InChIKey of (5R)-3,3-difluoro-5-(methoxymethyl)-1-methylpiperidine?
The InChIKey is LINOWXUJFNLRGE-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H15F2NO/c1-11-4-7(5-12-2)3-8(9,10)6-11/h7H,3-6H2,1-2H3/t7-/m1/s1.
What are the key properties of (5R)-3,3-difluoro-5-(methoxymethyl)-1-methylpiperidine?
(5R)-3,3-difluoro-5-(methoxymethyl)-1-methylpiperidine has a molecular weight of 179.21 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3,3-difluoro-5-(methoxymethyl)-1-methylpiperidine is sourced from PubChem (CID 166929234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).