C24H23F3N6O — CID 166929426
(1R,2R,4S)-N-[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]-7-azabicyclo[2.2.1]heptan-2-amine (PubChem CID 166929426) has the molecular formula C24H23F3N6O and a molecular weight of 468.48 g/mol. Its IUPAC name is (1R,2R,4S)-N-[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]-7-azabicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1R,2R,4S)-N-[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]-7-azabicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 166929426 |
| Molecular Formula | C24H23F3N6O |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | (1R,2R,4S)-N-[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]-7-azabicyclo[2.2.1]heptan-2-amine |
| SMILES | Cc1noc(C)c1-c1ccc2c(-c3nc(N[C@@H]4C[C@@H]5CC[C@H]4N5)ncc3C(F)(F)F)c[nH]c2c1 |
| InChI | InChI=1S/C24H23F3N6O/c1-11-21(12(2)34-33-11)13-3-5-15-16(9-28-19(15)7-13)22-17(24(25,26)27)10-29-23(32-22)31-20-8-14-4-6-18(20)30-14/h3,5,7,9-10,14,18,20,28,30H,4,6,8H2,1-2H3,(H,29,31,32)/t14-,18+,20+/m0/s1 |
| InChIKey | AGIYHWCUYXXVDE-BOUXLOLZSA-N |
| XLogP | 5.22 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |