C18H32O2 — CID 166929960
(2R,4aS,4bS,6R,8aS,10aS)-2,4a,7,7-tetramethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-1H-phenanthrene-2,6-diol (PubChem CID 166929960) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (2R,4aS,4bS,6R,8aS,10aS)-2,4a,7,7-tetramethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-1H-phenanthrene-2,6-diol.
| Compound Name | (2R,4aS,4bS,6R,8aS,10aS)-2,4a,7,7-tetramethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-1H-phenanthrene-2,6-diol |
|---|---|
| PubChem CID | 166929960 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (2R,4aS,4bS,6R,8aS,10aS)-2,4a,7,7-tetramethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-1H-phenanthrene-2,6-diol |
| SMILES | CC1(C)C[C@@H]2CC[C@H]3C[C@](C)(O)CC[C@]3(C)[C@H]2C[C@H]1O |
| InChI | InChI=1S/C18H32O2/c1-16(2)10-12-5-6-13-11-17(3,20)7-8-18(13,4)14(12)9-15(16)19/h12-15,19-20H,5-11H2,1-4H3/t12-,13-,14-,15+,17+,18-/m0/s1 |
| InChIKey | SZSCVXXEBPJPGQ-JVSYPLCOSA-N |
| XLogP | 3.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |