C18H19F6NO7 — CID 166930127
1,1,1,3,3,3-hexafluoropropan-2-yl 2-(2-morpholin-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 166930127) has the molecular formula C18H19F6NO7 and a molecular weight of 475.34 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-(2-morpholin-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-(2-morpholin-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 166930127 |
| Molecular Formula | C18H19F6NO7 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-(2-morpholin-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | O=C(CN1CCOCC1)OC1C2CC3C1OC(=O)C3C2C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H19F6NO7/c19-17(20,21)16(18(22,23)24)32-15(28)11-7-5-8-10(11)14(27)31-13(8)12(7)30-9(26)6-25-1-3-29-4-2-25/h7-8,10-13,16H,1-6H2 |
| InChIKey | AQFLOEOGAQSTOP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|