About [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-morpholin-4-ylacetate
[5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-morpholin-4-ylacetate (PubChem CID 166930163) has the molecular formula C15H18F3NO5
and a molecular weight of 349.31 g/mol. Its IUPAC name is [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-morpholin-4-ylacetate.
Molecular Properties
| Compound Name | [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-morpholin-4-ylacetate |
| PubChem CID | 166930163 |
| Molecular Formula | C15H18F3NO5 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-morpholin-4-ylacetate |
| SMILES | O=C(CN1CCOCC1)OC1C2CC3C1OC(=O)C3(C(F)(F)F)C2 |
| InChI | InChI=1S/C15H18F3NO5/c16-15(17,18)14-6-8-5-9(14)12(24-13(14)21)11(8)23-10(20)7-19-1-3-22-4-2-19/h8-9,11-12H,1-7H2 |
| InChIKey | QLSDRGNGRUWZTP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-morpholin-4-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-morpholin-4-ylacetate?
The IUPAC name of [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-morpholin-4-ylacetate (CID 166930163) is [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-morpholin-4-ylacetate.
What is the SMILES notation for [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-morpholin-4-ylacetate?
The canonical SMILES for [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-morpholin-4-ylacetate is O=C(CN1CCOCC1)OC1C2CC3C1OC(=O)C3(C(F)(F)F)C2.
What is the InChIKey of [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-morpholin-4-ylacetate?
The InChIKey is QLSDRGNGRUWZTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F3NO5/c16-15(17,18)14-6-8-5-9(14)12(24-13(14)21)11(8)23-10(20)7-19-1-3-22-4-2-19/h8-9,11-12H,1-7H2.
What are the key properties of [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-morpholin-4-ylacetate?
[5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-morpholin-4-ylacetate has a molecular weight of 349.31 g/mol, XLogP of 0.74, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-morpholin-4-ylacetate is sourced from PubChem (CID 166930163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).