About 2,2-difluoro-3-[[(2R)-5-(triethyl-λ4-sulfanyl)pent-4-yn-2-yl]amino]propan-1-ol
2,2-difluoro-3-[[(2R)-5-(triethyl-λ4-sulfanyl)pent-4-yn-2-yl]amino]propan-1-ol (PubChem CID 166930499) has the molecular formula C14H27F2NOS
and a molecular weight of 295.44 g/mol. Its IUPAC name is 2,2-difluoro-3-[[(2R)-5-(triethyl-λ4-sulfanyl)pent-4-yn-2-yl]amino]propan-1-ol.
Molecular Properties
| Compound Name | 2,2-difluoro-3-[[(2R)-5-(triethyl-λ4-sulfanyl)pent-4-yn-2-yl]amino]propan-1-ol |
| PubChem CID | 166930499 |
| Molecular Formula | C14H27F2NOS |
| Molecular Weight | 295.44 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2,2-difluoro-3-[[(2R)-5-(triethyl-λ4-sulfanyl)pent-4-yn-2-yl]amino]propan-1-ol |
| SMILES | CCS(C#CC[C@@H](C)NCC(F)(F)CO)(CC)CC |
| InChI | InChI=1S/C14H27F2NOS/c1-5-19(6-2,7-3)10-8-9-13(4)17-11-14(15,16)12-18/h13,17-18H,5-7,9,11-12H2,1-4H3/t13-/m1/s1 |
| InChIKey | BEHOPUBVHYDXSA-CYBMUJFWSA-N |
| XLogP | 2.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoro-3-[[(2R)-5-(triethyl-λ4-sulfanyl)pent-4-yn-2-yl]amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-3-[[(2R)-5-(triethyl-λ4-sulfanyl)pent-4-yn-2-yl]amino]propan-1-ol?
The IUPAC name of 2,2-difluoro-3-[[(2R)-5-(triethyl-λ4-sulfanyl)pent-4-yn-2-yl]amino]propan-1-ol (CID 166930499) is 2,2-difluoro-3-[[(2R)-5-(triethyl-λ4-sulfanyl)pent-4-yn-2-yl]amino]propan-1-ol.
What is the SMILES notation for 2,2-difluoro-3-[[(2R)-5-(triethyl-λ4-sulfanyl)pent-4-yn-2-yl]amino]propan-1-ol?
The canonical SMILES for 2,2-difluoro-3-[[(2R)-5-(triethyl-λ4-sulfanyl)pent-4-yn-2-yl]amino]propan-1-ol is CCS(C#CC[C@@H](C)NCC(F)(F)CO)(CC)CC.
What is the InChIKey of 2,2-difluoro-3-[[(2R)-5-(triethyl-λ4-sulfanyl)pent-4-yn-2-yl]amino]propan-1-ol?
The InChIKey is BEHOPUBVHYDXSA-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H27F2NOS/c1-5-19(6-2,7-3)10-8-9-13(4)17-11-14(15,16)12-18/h13,17-18H,5-7,9,11-12H2,1-4H3/t13-/m1/s1.
What are the key properties of 2,2-difluoro-3-[[(2R)-5-(triethyl-λ4-sulfanyl)pent-4-yn-2-yl]amino]propan-1-ol?
2,2-difluoro-3-[[(2R)-5-(triethyl-λ4-sulfanyl)pent-4-yn-2-yl]amino]propan-1-ol has a molecular weight of 295.44 g/mol, XLogP of 2.81, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-3-[[(2R)-5-(triethyl-λ4-sulfanyl)pent-4-yn-2-yl]amino]propan-1-ol is sourced from PubChem (CID 166930499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).