C12H21N5O — CID 166930522
(7S,9S,11S)-5-amino-11-methyl-9-(2-methylpropyl)-1,4,6,8-tetrazatricyclo[5.3.1.04,11]undec-5-en-10-one (PubChem CID 166930522) has the molecular formula C12H21N5O and a molecular weight of 251.33 g/mol. Its IUPAC name is (7S,9S,11S)-5-amino-11-methyl-9-(2-methylpropyl)-1,4,6,8-tetrazatricyclo[5.3.1.04,11]undec-5-en-10-one.
| Compound Name | (7S,9S,11S)-5-amino-11-methyl-9-(2-methylpropyl)-1,4,6,8-tetrazatricyclo[5.3.1.04,11]undec-5-en-10-one |
|---|---|
| PubChem CID | 166930522 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (7S,9S,11S)-5-amino-11-methyl-9-(2-methylpropyl)-1,4,6,8-tetrazatricyclo[5.3.1.04,11]undec-5-en-10-one |
| SMILES | CC(C)C[C@@H]1N[C@H]2N=C(N)N3CCN(C1=O)[C@@]23C |
| InChI | InChI=1S/C12H21N5O/c1-7(2)6-8-9(18)16-4-5-17-11(13)15-10(14-8)12(16,17)3/h7-8,10,14H,4-6H2,1-3H3,(H2,13,15)/t8-,10-,12+/m0/s1 |
| InChIKey | OCIHFTNJLLZYAD-PTOFAABTSA-N |
| XLogP | -0.48 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |