About (4R)-N,N,10-trimethyl-4-propyl-8-propylsulfanylundecan-1-amine
(4R)-N,N,10-trimethyl-4-propyl-8-propylsulfanylundecan-1-amine (PubChem CID 166930899) has the molecular formula C20H43NS
and a molecular weight of 329.64 g/mol. Its IUPAC name is (4R)-N,N,10-trimethyl-4-propyl-8-propylsulfanylundecan-1-amine.
Molecular Properties
| Compound Name | (4R)-N,N,10-trimethyl-4-propyl-8-propylsulfanylundecan-1-amine |
| PubChem CID | 166930899 |
| Molecular Formula | C20H43NS |
| Molecular Weight | 329.64 g/mol |
| Exact Mass | 329.31 |
| IUPAC Name | (4R)-N,N,10-trimethyl-4-propyl-8-propylsulfanylundecan-1-amine |
| SMILES | CCCSC(CCCC(CCC)CCCN(C)C)CC(C)C |
| InChI | InChI=1S/C20H43NS/c1-7-11-19(13-10-15-21(5)6)12-9-14-20(17-18(3)4)22-16-8-2/h18-20H,7-17H2,1-6H3 |
| InChIKey | UENBUXYPQKEOQD-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.64 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-N,N,10-trimethyl-4-propyl-8-propylsulfanylundecan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-N,N,10-trimethyl-4-propyl-8-propylsulfanylundecan-1-amine?
The IUPAC name of (4R)-N,N,10-trimethyl-4-propyl-8-propylsulfanylundecan-1-amine (CID 166930899) is (4R)-N,N,10-trimethyl-4-propyl-8-propylsulfanylundecan-1-amine.
What is the SMILES notation for (4R)-N,N,10-trimethyl-4-propyl-8-propylsulfanylundecan-1-amine?
The canonical SMILES for (4R)-N,N,10-trimethyl-4-propyl-8-propylsulfanylundecan-1-amine is CCCSC(CCCC(CCC)CCCN(C)C)CC(C)C.
What is the InChIKey of (4R)-N,N,10-trimethyl-4-propyl-8-propylsulfanylundecan-1-amine?
The InChIKey is UENBUXYPQKEOQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H43NS/c1-7-11-19(13-10-15-21(5)6)12-9-14-20(17-18(3)4)22-16-8-2/h18-20H,7-17H2,1-6H3.
What are the key properties of (4R)-N,N,10-trimethyl-4-propyl-8-propylsulfanylundecan-1-amine?
(4R)-N,N,10-trimethyl-4-propyl-8-propylsulfanylundecan-1-amine has a molecular weight of 329.64 g/mol, XLogP of 6.47, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-N,N,10-trimethyl-4-propyl-8-propylsulfanylundecan-1-amine is sourced from PubChem (CID 166930899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).