C16H32N2 — CID 166931385
1-N-ethenyl-7,7-dimethyl-6-methylidene-5-N-propan-2-yloctane-1,5-diamine (PubChem CID 166931385) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 1-N-ethenyl-7,7-dimethyl-6-methylidene-5-N-propan-2-yloctane-1,5-diamine.
| Compound Name | 1-N-ethenyl-7,7-dimethyl-6-methylidene-5-N-propan-2-yloctane-1,5-diamine |
|---|---|
| PubChem CID | 166931385 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 1-N-ethenyl-7,7-dimethyl-6-methylidene-5-N-propan-2-yloctane-1,5-diamine |
| SMILES | C=CNCCCCC(NC(C)C)C(=C)C(C)(C)C |
| InChI | InChI=1S/C16H32N2/c1-8-17-12-10-9-11-15(18-13(2)3)14(4)16(5,6)7/h8,13,15,17-18H,1,4,9-12H2,2-3,5-7H3 |
| InChIKey | GHGZACGPQWTVSO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|