About thioxanthylium
thioxanthylium (PubChem CID 16693193) has the molecular formula C13H9S+
and a molecular weight of 197.28 g/mol. Its IUPAC name is thioxanthylium.
Molecular Properties
| Compound Name | thioxanthylium |
| PubChem CID | 16693193 |
| Molecular Formula | C13H9S+ |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | thioxanthylium |
| SMILES | c1ccc2[s+]c3ccccc3cc2c1 |
| InChI | InChI=1S/C13H9S/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H/q+1 |
| InChIKey | GPTCOAHVPPDCNL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze thioxanthylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thioxanthylium?
The IUPAC name of thioxanthylium (CID 16693193) is thioxanthylium.
What is the SMILES notation for thioxanthylium?
The canonical SMILES for thioxanthylium is c1ccc2[s+]c3ccccc3cc2c1.
What is the InChIKey of thioxanthylium?
The InChIKey is GPTCOAHVPPDCNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9S/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H/q+1.
What are the key properties of thioxanthylium?
thioxanthylium has a molecular weight of 197.28 g/mol, XLogP of 4.34, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for thioxanthylium is sourced from PubChem (CID 16693193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).