C17H19N3 — CID 166931997
(10R)-8,9,11-trimethyl-1,11,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12(17),13,15-hexaene (PubChem CID 166931997) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is (10R)-8,9,11-trimethyl-1,11,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12(17),13,15-hexaene.
| Compound Name | (10R)-8,9,11-trimethyl-1,11,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12(17),13,15-hexaene |
|---|---|
| PubChem CID | 166931997 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | (10R)-8,9,11-trimethyl-1,11,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12(17),13,15-hexaene |
| SMILES | CC1c2ccccc2N2c3ncccc3N(C)[C@H]2C1C |
| InChI | InChI=1S/C17H19N3/c1-11-12(2)17-19(3)15-9-6-10-18-16(15)20(17)14-8-5-4-7-13(11)14/h4-12,17H,1-3H3/t11?,12?,17-/m1/s1 |
| InChIKey | QCUKGDRJZDOYPA-VCMHEYGDSA-N |
| XLogP | 3.75 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |