C22H31FN2O2 — CID 166932067
N-[2-amino-2-(4-formylcyclohexyl)ethyl]-1-(4-fluorophenyl)cyclohexane-1-carboxamide (PubChem CID 166932067) has the molecular formula C22H31FN2O2 and a molecular weight of 374.50 g/mol. Its IUPAC name is N-[2-amino-2-(4-formylcyclohexyl)ethyl]-1-(4-fluorophenyl)cyclohexane-1-carboxamide.
| Compound Name | N-[2-amino-2-(4-formylcyclohexyl)ethyl]-1-(4-fluorophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 166932067 |
| Molecular Formula | C22H31FN2O2 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | N-[2-amino-2-(4-formylcyclohexyl)ethyl]-1-(4-fluorophenyl)cyclohexane-1-carboxamide |
| SMILES | NC(CNC(=O)C1(c2ccc(F)cc2)CCCCC1)C1CCC(C=O)CC1 |
| InChI | InChI=1S/C22H31FN2O2/c23-19-10-8-18(9-11-19)22(12-2-1-3-13-22)21(27)25-14-20(24)17-6-4-16(15-26)5-7-17/h8-11,15-17,20H,1-7,12-14,24H2,(H,25,27) |
| InChIKey | RXVLLDSLRPHKPD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|