C16H20N4 — CID 166932134
(3Z,5Z)-5-hydrazinyl-3-[(1Z,3Z)-penta-1,3-dienyl]-1,2-dihydro-1-benzazocin-6-amine (PubChem CID 166932134) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is (3Z,5Z)-5-hydrazinyl-3-[(1Z,3Z)-penta-1,3-dienyl]-1,2-dihydro-1-benzazocin-6-amine.
| Compound Name | (3Z,5Z)-5-hydrazinyl-3-[(1Z,3Z)-penta-1,3-dienyl]-1,2-dihydro-1-benzazocin-6-amine |
|---|---|
| PubChem CID | 166932134 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (3Z,5Z)-5-hydrazinyl-3-[(1Z,3Z)-penta-1,3-dienyl]-1,2-dihydro-1-benzazocin-6-amine |
| SMILES | C/C=C\C=C/C1=C/C(NN)=C(/N)c2ccccc2NC1 |
| InChI | InChI=1S/C16H20N4/c1-2-3-4-7-12-10-15(20-18)16(17)13-8-5-6-9-14(13)19-11-12/h2-10,19-20H,11,17-18H2,1H3/b3-2-,7-4-,12-10-,16-15- |
| InChIKey | UNKXXXVQYWAZSZ-SNIMYREXSA-N |
| XLogP | 2.26 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|