About 5-(2,4-dimethylpentan-2-yl)-4,5-dihydro-1H-imidazol-2-amine
5-(2,4-dimethylpentan-2-yl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 166932185) has the molecular formula C10H21N3
and a molecular weight of 183.30 g/mol. Its IUPAC name is 5-(2,4-dimethylpentan-2-yl)-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | 5-(2,4-dimethylpentan-2-yl)-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 166932185 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 5-(2,4-dimethylpentan-2-yl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CC(C)CC(C)(C)C1CN=C(N)N1 |
| InChI | InChI=1S/C10H21N3/c1-7(2)5-10(3,4)8-6-12-9(11)13-8/h7-8H,5-6H2,1-4H3,(H3,11,12,13) |
| InChIKey | FFVPFJTWYLUGOH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2,4-dimethylpentan-2-yl)-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dimethylpentan-2-yl)-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of 5-(2,4-dimethylpentan-2-yl)-4,5-dihydro-1H-imidazol-2-amine (CID 166932185) is 5-(2,4-dimethylpentan-2-yl)-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for 5-(2,4-dimethylpentan-2-yl)-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for 5-(2,4-dimethylpentan-2-yl)-4,5-dihydro-1H-imidazol-2-amine is CC(C)CC(C)(C)C1CN=C(N)N1.
What is the InChIKey of 5-(2,4-dimethylpentan-2-yl)-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is FFVPFJTWYLUGOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3/c1-7(2)5-10(3,4)8-6-12-9(11)13-8/h7-8H,5-6H2,1-4H3,(H3,11,12,13).
What are the key properties of 5-(2,4-dimethylpentan-2-yl)-4,5-dihydro-1H-imidazol-2-amine?
5-(2,4-dimethylpentan-2-yl)-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 183.30 g/mol, XLogP of 1.35, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dimethylpentan-2-yl)-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 166932185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).