About N,3-diethylpyrazolo[1,5-a]pyrimidin-5-amine
N,3-diethylpyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 166932513) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is N,3-diethylpyrazolo[1,5-a]pyrimidin-5-amine.
Molecular Properties
| Compound Name | N,3-diethylpyrazolo[1,5-a]pyrimidin-5-amine |
| PubChem CID | 166932513 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | N,3-diethylpyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | CCNc1ccn2ncc(CC)c2n1 |
| InChI | InChI=1S/C10H14N4/c1-3-8-7-12-14-6-5-9(11-4-2)13-10(8)14/h5-7H,3-4H2,1-2H3,(H,11,13) |
| InChIKey | AYJFCNBUVMYADS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,3-diethylpyrazolo[1,5-a]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-diethylpyrazolo[1,5-a]pyrimidin-5-amine?
The IUPAC name of N,3-diethylpyrazolo[1,5-a]pyrimidin-5-amine (CID 166932513) is N,3-diethylpyrazolo[1,5-a]pyrimidin-5-amine.
What is the SMILES notation for N,3-diethylpyrazolo[1,5-a]pyrimidin-5-amine?
The canonical SMILES for N,3-diethylpyrazolo[1,5-a]pyrimidin-5-amine is CCNc1ccn2ncc(CC)c2n1.
What is the InChIKey of N,3-diethylpyrazolo[1,5-a]pyrimidin-5-amine?
The InChIKey is AYJFCNBUVMYADS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c1-3-8-7-12-14-6-5-9(11-4-2)13-10(8)14/h5-7H,3-4H2,1-2H3,(H,11,13).
What are the key properties of N,3-diethylpyrazolo[1,5-a]pyrimidin-5-amine?
N,3-diethylpyrazolo[1,5-a]pyrimidin-5-amine has a molecular weight of 190.25 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-diethylpyrazolo[1,5-a]pyrimidin-5-amine is sourced from PubChem (CID 166932513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).