C19H25N5 — CID 166932609
N-[1-[1-(cyclohepta-1,4,6-trien-1-ylmethylamino)prop-1-enyl]-4-cyclopropylpyrazol-5-yl]-N'-methylmethanimidamide (PubChem CID 166932609) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-[1-[1-(cyclohepta-1,4,6-trien-1-ylmethylamino)prop-1-enyl]-4-cyclopropylpyrazol-5-yl]-N'-methylmethanimidamide.
| Compound Name | N-[1-[1-(cyclohepta-1,4,6-trien-1-ylmethylamino)prop-1-enyl]-4-cyclopropylpyrazol-5-yl]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 166932609 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N-[1-[1-(cyclohepta-1,4,6-trien-1-ylmethylamino)prop-1-enyl]-4-cyclopropylpyrazol-5-yl]-N'-methylmethanimidamide |
| SMILES | CC=C(NCC1=CCC=CC=C1)n1ncc(C2CC2)c1N/C=N/C |
| InChI | InChI=1S/C19H25N5/c1-3-18(21-12-15-8-6-4-5-7-9-15)24-19(22-14-20-2)17(13-23-24)16-10-11-16/h3-6,8-9,13-14,16,21H,7,10-12H2,1-2H3,(H,20,22) |
| InChIKey | NKWWKPIKDLQKHM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|