C36H36N2O4S — CID 166933043
[(E)-[1-[6-(2,5-dimethylcyclohexa-1,5-diene-1-carbonyl)-9-ethylcarbazol-3-yl]-4-(4-methylphenyl)sulfanyl-1-oxobutan-2-ylidene]amino] acetate (PubChem CID 166933043) has the molecular formula C36H36N2O4S and a molecular weight of 592.76 g/mol. Its IUPAC name is [(E)-[1-[6-(2,5-dimethylcyclohexa-1,5-diene-1-carbonyl)-9-ethylcarbazol-3-yl]-4-(4-methylphenyl)sulfanyl-1-oxobutan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[6-(2,5-dimethylcyclohexa-1,5-diene-1-carbonyl)-9-ethylcarbazol-3-yl]-4-(4-methylphenyl)sulfanyl-1-oxobutan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 166933043 |
| Molecular Formula | C36H36N2O4S |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | [(E)-[1-[6-(2,5-dimethylcyclohexa-1,5-diene-1-carbonyl)-9-ethylcarbazol-3-yl]-4-(4-methylphenyl)sulfanyl-1-oxobutan-2-ylidene]amino] acetate |
| SMILES | CCn1c2ccc(C(=O)C3=C(C)CCC(C)=C3)cc2c2cc(C(=O)/C(CCSc3ccc(C)cc3)=N/OC(C)=O)ccc21 |
| InChI | InChI=1S/C36H36N2O4S/c1-6-38-33-15-11-26(35(40)29-19-23(3)7-10-24(29)4)20-30(33)31-21-27(12-16-34(31)38)36(41)32(37-42-25(5)39)17-18-43-28-13-8-22(2)9-14-28/h8-9,11-16,19-21H,6-7,10,17-18H2,1-5H3/b37-32+ |
| InChIKey | SILFUOQHJFOWND-BQNXFWFHSA-N |
| XLogP | 8.65 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|