C60H40N4O — CID 166933243
6-[4-[(3E,5E)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)hepta-1,3,5-trien-3-yl]phenyl]spiro[chromeno[3,2-k]phenanthridine-9,9'-fluorene] (PubChem CID 166933243) has the molecular formula C60H40N4O and a molecular weight of 833.01 g/mol. Its IUPAC name is 6-[4-[(3E,5E)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)hepta-1,3,5-trien-3-yl]phenyl]spiro[chromeno[3,2-k]phenanthridine-9,9'-fluorene].
| Compound Name | 6-[4-[(3E,5E)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)hepta-1,3,5-trien-3-yl]phenyl]spiro[chromeno[3,2-k]phenanthridine-9,9'-fluorene] |
|---|---|
| PubChem CID | 166933243 |
| Molecular Formula | C60H40N4O |
| Molecular Weight | 833.01 g/mol |
| Exact Mass | 832.32 |
| IUPAC Name | 6-[4-[(3E,5E)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)hepta-1,3,5-trien-3-yl]phenyl]spiro[chromeno[3,2-k]phenanthridine-9,9'-fluorene] |
| SMILES | C=C/C(=C\C=C(/C)c1nc(-c2ccccc2)nc(-c2ccccc2)n1)c1ccc(-c2nc3ccccc3c3c4c(ccc23)C2(c3ccccc3O4)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C60H40N4O/c1-3-39(31-30-38(2)57-62-58(42-18-6-4-7-19-42)64-59(63-57)43-20-8-5-9-21-43)40-32-34-41(35-33-40)55-47-36-37-51-56(54(47)46-24-12-16-28-52(46)61-55)65-53-29-17-15-27-50(53)60(51)48-25-13-10-22-44(48)45-23-11-14-26-49(45)60/h3-37H,1H2,2H3/b38-30+,39-31+ |
| InChIKey | UXJFFQNARVPGOI-JRXDEDDOSA-N |
| XLogP | 14.72 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.01 |
| LogP ≤ 5 | 14.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|