C24H34N8O5 — CID 166934069
N-[(4S,10R)-2,6-diamino-10-hydroxy-4-[[(2-methoxyacetyl)amino]methyl]-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-4,4-dimethyl-2,3-dihydrochromene-8-carboxamide (PubChem CID 166934069) has the molecular formula C24H34N8O5 and a molecular weight of 514.59 g/mol. Its IUPAC name is N-[(4S,10R)-2,6-diamino-10-hydroxy-4-[[(2-methoxyacetyl)amino]methyl]-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-4,4-dimethyl-2,3-dihydrochromene-8-carboxamide.
| Compound Name | N-[(4S,10R)-2,6-diamino-10-hydroxy-4-[[(2-methoxyacetyl)amino]methyl]-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-4,4-dimethyl-2,3-dihydrochromene-8-carboxamide |
|---|---|
| PubChem CID | 166934069 |
| Molecular Formula | C24H34N8O5 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | N-[(4S,10R)-2,6-diamino-10-hydroxy-4-[[(2-methoxyacetyl)amino]methyl]-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-4,4-dimethyl-2,3-dihydrochromene-8-carboxamide |
| SMILES | COCC(=O)NC[C@@H]1N=C(N)N2CC(NC(=O)c3cccc4c3OCCC4(C)C)[C@@H](O)C23NC(N)=NC13 |
| InChI | InChI=1S/C24H34N8O5/c1-23(2)7-8-37-17-12(5-4-6-13(17)23)20(35)28-15-10-32-22(26)29-14(9-27-16(33)11-36-3)18-24(32,19(15)34)31-21(25)30-18/h4-6,14-15,18-19,34H,7-11H2,1-3H3,(H2,26,29)(H,27,33)(H,28,35)(H3,25,30,31)/t14-,15?,18?,19+,24?/m0/s1 |
| InChIKey | NLIGNAIGFWAWMU-KAGRZCGKSA-N |
| XLogP | -2.04 |
| TPSA | 188.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |