C29H33F3N8O5 — CID 166934225
N-[2,6-diamino-10,10-dihydroxy-4-[[[4-(trifluoromethyl)benzoyl]amino]methyl]-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-4,4-dimethyl-2,3-dihydrochromene-8-carboxamide (PubChem CID 166934225) has the molecular formula C29H33F3N8O5 and a molecular weight of 630.63 g/mol. Its IUPAC name is N-[2,6-diamino-10,10-dihydroxy-4-[[[4-(trifluoromethyl)benzoyl]amino]methyl]-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-4,4-dimethyl-2,3-dihydrochromene-8-carboxamide.
| Compound Name | N-[2,6-diamino-10,10-dihydroxy-4-[[[4-(trifluoromethyl)benzoyl]amino]methyl]-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-4,4-dimethyl-2,3-dihydrochromene-8-carboxamide |
|---|---|
| PubChem CID | 166934225 |
| Molecular Formula | C29H33F3N8O5 |
| Molecular Weight | 630.63 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | N-[2,6-diamino-10,10-dihydroxy-4-[[[4-(trifluoromethyl)benzoyl]amino]methyl]-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-4,4-dimethyl-2,3-dihydrochromene-8-carboxamide |
| SMILES | CC1(C)CCOc2c(C(=O)NC3CN4C(N)=NC(CNC(=O)c5ccc(C(F)(F)F)cc5)C5N=C(N)NC54C3(O)O)cccc21 |
| InChI | InChI=1S/C29H33F3N8O5/c1-26(2)10-11-45-20-16(4-3-5-17(20)26)23(42)37-19-13-40-25(34)36-18(21-27(40,28(19,43)44)39-24(33)38-21)12-35-22(41)14-6-8-15(9-7-14)29(30,31)32/h3-9,18-19,21,43-44H,10-13H2,1-2H3,(H2,34,36)(H,35,41)(H,37,42)(H3,33,38,39) |
| InChIKey | VNCWRNMSZLCDDH-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 199.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.63 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|