About 2-hydroxy-6-(5-oxo-1H-1,2,4-triazol-4-yl)-3H-isoindol-1-one
2-hydroxy-6-(5-oxo-1H-1,2,4-triazol-4-yl)-3H-isoindol-1-one (PubChem CID 166935910) has the molecular formula C10H8N4O3
and a molecular weight of 232.20 g/mol. Its IUPAC name is 2-hydroxy-6-(5-oxo-1H-1,2,4-triazol-4-yl)-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 2-hydroxy-6-(5-oxo-1H-1,2,4-triazol-4-yl)-3H-isoindol-1-one |
| PubChem CID | 166935910 |
| Molecular Formula | C10H8N4O3 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 2-hydroxy-6-(5-oxo-1H-1,2,4-triazol-4-yl)-3H-isoindol-1-one |
| SMILES | O=C1c2cc(-n3cn[nH]c3=O)ccc2CN1O |
| InChI | InChI=1S/C10H8N4O3/c15-9-8-3-7(13-5-11-12-10(13)16)2-1-6(8)4-14(9)17/h1-3,5,17H,4H2,(H,12,16) |
| InChIKey | WAMOWHSBNFJPQX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-6-(5-oxo-1H-1,2,4-triazol-4-yl)-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-6-(5-oxo-1H-1,2,4-triazol-4-yl)-3H-isoindol-1-one?
The IUPAC name of 2-hydroxy-6-(5-oxo-1H-1,2,4-triazol-4-yl)-3H-isoindol-1-one (CID 166935910) is 2-hydroxy-6-(5-oxo-1H-1,2,4-triazol-4-yl)-3H-isoindol-1-one.
What is the SMILES notation for 2-hydroxy-6-(5-oxo-1H-1,2,4-triazol-4-yl)-3H-isoindol-1-one?
The canonical SMILES for 2-hydroxy-6-(5-oxo-1H-1,2,4-triazol-4-yl)-3H-isoindol-1-one is O=C1c2cc(-n3cn[nH]c3=O)ccc2CN1O.
What is the InChIKey of 2-hydroxy-6-(5-oxo-1H-1,2,4-triazol-4-yl)-3H-isoindol-1-one?
The InChIKey is WAMOWHSBNFJPQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4O3/c15-9-8-3-7(13-5-11-12-10(13)16)2-1-6(8)4-14(9)17/h1-3,5,17H,4H2,(H,12,16).
What are the key properties of 2-hydroxy-6-(5-oxo-1H-1,2,4-triazol-4-yl)-3H-isoindol-1-one?
2-hydroxy-6-(5-oxo-1H-1,2,4-triazol-4-yl)-3H-isoindol-1-one has a molecular weight of 232.20 g/mol, XLogP of -0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-6-(5-oxo-1H-1,2,4-triazol-4-yl)-3H-isoindol-1-one is sourced from PubChem (CID 166935910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).