About CID 16693640
CID 16693640 (PubChem CID 16693640) has the molecular formula C6H4OSSb
and a molecular weight of 245.92 g/mol.
Molecular Properties
| Compound Name | CID 16693640 |
| PubChem CID | 16693640 |
| Molecular Formula | C6H4OSSb |
| Molecular Weight | 245.92 g/mol |
| Exact Mass | 244.90 |
| IUPAC Name | — |
| SMILES | c1ccc2c(c1)O[Sb]S2 |
| InChI | InChI=1S/C6H6OS.Sb/c7-5-3-1-2-4-6(5)8;/h1-4,7-8H;/q;+2/p-2 |
| InChIKey | VXTRODCODAQEAD-UHFFFAOYSA-L |
| XLogP | 1.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.92 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 16693640 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 16693640?
The IUPAC name of CID 16693640 (CID 16693640) is not available.
What is the SMILES notation for CID 16693640?
The canonical SMILES for CID 16693640 is c1ccc2c(c1)O[Sb]S2.
What is the InChIKey of CID 16693640?
The InChIKey is VXTRODCODAQEAD-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H6OS.Sb/c7-5-3-1-2-4-6(5)8;/h1-4,7-8H;/q;+2/p-2.
What are the key properties of CID 16693640?
CID 16693640 has a molecular weight of 245.92 g/mol, XLogP of 1.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 16693640 is sourced from PubChem (CID 16693640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).