C15H15N3O4S — CID 166937622
5-(3-hydroxy-4-methoxyphenyl)-2-methylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 166937622) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is 5-(3-hydroxy-4-methoxyphenyl)-2-methylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(3-hydroxy-4-methoxyphenyl)-2-methylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 166937622 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 5-(3-hydroxy-4-methoxyphenyl)-2-methylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | COc1ccc(C2CC(=O)Nc3nc(SC)[nH]c(=O)c32)cc1O |
| InChI | InChI=1S/C15H15N3O4S/c1-22-10-4-3-7(5-9(10)19)8-6-11(20)16-13-12(8)14(21)18-15(17-13)23-2/h3-5,8,19H,6H2,1-2H3,(H2,16,17,18,20,21) |
| InChIKey | PITJZOGLUSLAOP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |