C11H8F7NO2S2 — CID 166937653
N-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)-N-(2-methylphenyl)sulfinylformamide (PubChem CID 166937653) has the molecular formula C11H8F7NO2S2 and a molecular weight of 383.31 g/mol. Its IUPAC name is N-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)-N-(2-methylphenyl)sulfinylformamide.
| Compound Name | N-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)-N-(2-methylphenyl)sulfinylformamide |
|---|---|
| PubChem CID | 166937653 |
| Molecular Formula | C11H8F7NO2S2 |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | N-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)-N-(2-methylphenyl)sulfinylformamide |
| SMILES | Cc1ccccc1S(=O)N(C=O)SC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H8F7NO2S2/c1-7-4-2-3-5-8(7)23(21)19(6-20)22-9(12,10(13,14)15)11(16,17)18/h2-6H,1H3 |
| InChIKey | ZKTOCHHTPBBBBC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|