About 8-(phosphanylamino)-3,4-dihydro-1H-naphthalen-2-one
8-(phosphanylamino)-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 166937900) has the molecular formula C10H12NOP
and a molecular weight of 193.19 g/mol. Its IUPAC name is 8-(phosphanylamino)-3,4-dihydro-1H-naphthalen-2-one.
Molecular Properties
| Compound Name | 8-(phosphanylamino)-3,4-dihydro-1H-naphthalen-2-one |
| PubChem CID | 166937900 |
| Molecular Formula | C10H12NOP |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 8-(phosphanylamino)-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | O=C1CCc2cccc(NP)c2C1 |
| InChI | InChI=1S/C10H12NOP/c12-8-5-4-7-2-1-3-10(11-13)9(7)6-8/h1-3,11H,4-6,13H2 |
| InChIKey | XYMRXJMKIRSQCD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 8-(phosphanylamino)-3,4-dihydro-1H-naphthalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(phosphanylamino)-3,4-dihydro-1H-naphthalen-2-one?
The IUPAC name of 8-(phosphanylamino)-3,4-dihydro-1H-naphthalen-2-one (CID 166937900) is 8-(phosphanylamino)-3,4-dihydro-1H-naphthalen-2-one.
What is the SMILES notation for 8-(phosphanylamino)-3,4-dihydro-1H-naphthalen-2-one?
The canonical SMILES for 8-(phosphanylamino)-3,4-dihydro-1H-naphthalen-2-one is O=C1CCc2cccc(NP)c2C1.
What is the InChIKey of 8-(phosphanylamino)-3,4-dihydro-1H-naphthalen-2-one?
The InChIKey is XYMRXJMKIRSQCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12NOP/c12-8-5-4-7-2-1-3-10(11-13)9(7)6-8/h1-3,11H,4-6,13H2.
What are the key properties of 8-(phosphanylamino)-3,4-dihydro-1H-naphthalen-2-one?
8-(phosphanylamino)-3,4-dihydro-1H-naphthalen-2-one has a molecular weight of 193.19 g/mol, XLogP of 1.95, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(phosphanylamino)-3,4-dihydro-1H-naphthalen-2-one is sourced from PubChem (CID 166937900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).