C34H39NO9 — CID 166938001
1-O-[(2S,6R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl 2-hydroxy-2-[(E)-4-phenylmethoxybut-2-enyl]butanedioate (PubChem CID 166938001) has the molecular formula C34H39NO9 and a molecular weight of 605.68 g/mol. Its IUPAC name is 1-O-[(2S,6R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl 2-hydroxy-2-[(E)-4-phenylmethoxybut-2-enyl]butanedioate.
| Compound Name | 1-O-[(2S,6R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl 2-hydroxy-2-[(E)-4-phenylmethoxybut-2-enyl]butanedioate |
|---|---|
| PubChem CID | 166938001 |
| Molecular Formula | C34H39NO9 |
| Molecular Weight | 605.68 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | 1-O-[(2S,6R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl 2-hydroxy-2-[(E)-4-phenylmethoxybut-2-enyl]butanedioate |
| SMILES | COC(=O)CC(O)(C/C=C/COCc1ccccc1)C(=O)OC1C(OC)=C[C@]23CCCN2CCc2cc4c(cc2[C@H]13)OCO4 |
| InChI | InChI=1S/C34H39NO9/c1-39-28-19-33-12-8-14-35(33)15-11-24-17-26-27(43-22-42-26)18-25(24)30(33)31(28)44-32(37)34(38,20-29(36)40-2)13-6-7-16-41-21-23-9-4-3-5-10-23/h3-7,9-10,17-19,30-31,38H,8,11-16,20-22H2,1-2H3/b7-6+/t30-,31?,33+,34?/m1/s1 |
| InChIKey | HCKBEXOQBHFOTR-FQIOCLJJSA-N |
| XLogP | 3.80 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.68 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|