C21H12FN3O5 — CID 166938010
3-(5-amino-[1,3]dioxolo[4,5-f]indol-7-yl)-4-(5-fluoro-1-benzofuran-3-yl)pyrrole-2,5-dione (PubChem CID 166938010) has the molecular formula C21H12FN3O5 and a molecular weight of 405.34 g/mol. Its IUPAC name is 3-(5-amino-[1,3]dioxolo[4,5-f]indol-7-yl)-4-(5-fluoro-1-benzofuran-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(5-amino-[1,3]dioxolo[4,5-f]indol-7-yl)-4-(5-fluoro-1-benzofuran-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 166938010 |
| Molecular Formula | C21H12FN3O5 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 3-(5-amino-[1,3]dioxolo[4,5-f]indol-7-yl)-4-(5-fluoro-1-benzofuran-3-yl)pyrrole-2,5-dione |
| SMILES | Nn1cc(C2=C(c3coc4ccc(F)cc34)C(=O)NC2=O)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C21H12FN3O5/c22-9-1-2-15-11(3-9)13(7-28-15)19-18(20(26)24-21(19)27)12-6-25(23)14-5-17-16(4-10(12)14)29-8-30-17/h1-7H,8,23H2,(H,24,26,27) |
| InChIKey | RKJHKFOPJSBTJD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|