About 2-pentylazirino[2,3-b]quinoline
2-pentylazirino[2,3-b]quinoline (PubChem CID 166938444) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is 2-pentylazirino[2,3-b]quinoline.
Molecular Properties
| Compound Name | 2-pentylazirino[2,3-b]quinoline |
| PubChem CID | 166938444 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-pentylazirino[2,3-b]quinoline |
| SMILES | CCCCCN1C2=NC2=Cc2ccccc21 |
| InChI | InChI=1S/C14H16N2/c1-2-3-6-9-16-13-8-5-4-7-11(13)10-12-14(16)15-12/h4-5,7-8,10H,2-3,6,9H2,1H3 |
| InChIKey | BOIFOAWOEQULJM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentylazirino[2,3-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentylazirino[2,3-b]quinoline?
The IUPAC name of 2-pentylazirino[2,3-b]quinoline (CID 166938444) is 2-pentylazirino[2,3-b]quinoline.
What is the SMILES notation for 2-pentylazirino[2,3-b]quinoline?
The canonical SMILES for 2-pentylazirino[2,3-b]quinoline is CCCCCN1C2=NC2=Cc2ccccc21.
What is the InChIKey of 2-pentylazirino[2,3-b]quinoline?
The InChIKey is BOIFOAWOEQULJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2/c1-2-3-6-9-16-13-8-5-4-7-11(13)10-12-14(16)15-12/h4-5,7-8,10H,2-3,6,9H2,1H3.
What are the key properties of 2-pentylazirino[2,3-b]quinoline?
2-pentylazirino[2,3-b]quinoline has a molecular weight of 212.30 g/mol, XLogP of 3.45, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentylazirino[2,3-b]quinoline is sourced from PubChem (CID 166938444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).