About 6-(propan-2-yldisulfanyl)-2,3-dihydropyridine
6-(propan-2-yldisulfanyl)-2,3-dihydropyridine (PubChem CID 166938735) has the molecular formula C8H13NS2
and a molecular weight of 187.33 g/mol. Its IUPAC name is 6-(propan-2-yldisulfanyl)-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 6-(propan-2-yldisulfanyl)-2,3-dihydropyridine |
| PubChem CID | 166938735 |
| Molecular Formula | C8H13NS2 |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 6-(propan-2-yldisulfanyl)-2,3-dihydropyridine |
| SMILES | CC(C)SSC1=NCCC=C1 |
| InChI | InChI=1S/C8H13NS2/c1-7(2)10-11-8-5-3-4-6-9-8/h3,5,7H,4,6H2,1-2H3 |
| InChIKey | RDMHHFUMHIEFTG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 6-(propan-2-yldisulfanyl)-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(propan-2-yldisulfanyl)-2,3-dihydropyridine?
The IUPAC name of 6-(propan-2-yldisulfanyl)-2,3-dihydropyridine (CID 166938735) is 6-(propan-2-yldisulfanyl)-2,3-dihydropyridine.
What is the SMILES notation for 6-(propan-2-yldisulfanyl)-2,3-dihydropyridine?
The canonical SMILES for 6-(propan-2-yldisulfanyl)-2,3-dihydropyridine is CC(C)SSC1=NCCC=C1.
What is the InChIKey of 6-(propan-2-yldisulfanyl)-2,3-dihydropyridine?
The InChIKey is RDMHHFUMHIEFTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NS2/c1-7(2)10-11-8-5-3-4-6-9-8/h3,5,7H,4,6H2,1-2H3.
What are the key properties of 6-(propan-2-yldisulfanyl)-2,3-dihydropyridine?
6-(propan-2-yldisulfanyl)-2,3-dihydropyridine has a molecular weight of 187.33 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(propan-2-yldisulfanyl)-2,3-dihydropyridine is sourced from PubChem (CID 166938735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).