C8H4O4Pb — CID 16693909
2,4,3λ2-benzodioxaplumbepine-1,5-dione (PubChem CID 16693909) has the molecular formula C8H4O4Pb and a molecular weight of 371.32 g/mol. Its IUPAC name is 2,4,3λ2-benzodioxaplumbepine-1,5-dione.
| Compound Name | 2,4,3λ2-benzodioxaplumbepine-1,5-dione |
|---|---|
| PubChem CID | 16693909 |
| Molecular Formula | C8H4O4Pb |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 2,4,3λ2-benzodioxaplumbepine-1,5-dione |
| SMILES | O=C1O[Pb]OC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H6O4.Pb/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);/q;+2/p-2 |
| InChIKey | YJOMWQQKPKLUBO-UHFFFAOYSA-L |
| XLogP | 0.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |