About (5Z,6E)-6-(2-chloropropylidene)-5-ethylidene-3,4-dihydropyridine
(5Z,6E)-6-(2-chloropropylidene)-5-ethylidene-3,4-dihydropyridine (PubChem CID 166940445) has the molecular formula C10H14ClN
and a molecular weight of 183.68 g/mol. Its IUPAC name is (5Z,6E)-6-(2-chloropropylidene)-5-ethylidene-3,4-dihydropyridine.
Molecular Properties
| Compound Name | (5Z,6E)-6-(2-chloropropylidene)-5-ethylidene-3,4-dihydropyridine |
| PubChem CID | 166940445 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | (5Z,6E)-6-(2-chloropropylidene)-5-ethylidene-3,4-dihydropyridine |
| SMILES | C/C=C1/CCC=N/C1=C/C(C)Cl |
| InChI | InChI=1S/C10H14ClN/c1-3-9-5-4-6-12-10(9)7-8(2)11/h3,6-8H,4-5H2,1-2H3/b9-3-,10-7+ |
| InChIKey | HBVHDMKIKYJMEX-CZRQHEBESA-N |
| XLogP | 3.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (5Z,6E)-6-(2-chloropropylidene)-5-ethylidene-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,6E)-6-(2-chloropropylidene)-5-ethylidene-3,4-dihydropyridine?
The IUPAC name of (5Z,6E)-6-(2-chloropropylidene)-5-ethylidene-3,4-dihydropyridine (CID 166940445) is (5Z,6E)-6-(2-chloropropylidene)-5-ethylidene-3,4-dihydropyridine.
What is the SMILES notation for (5Z,6E)-6-(2-chloropropylidene)-5-ethylidene-3,4-dihydropyridine?
The canonical SMILES for (5Z,6E)-6-(2-chloropropylidene)-5-ethylidene-3,4-dihydropyridine is C/C=C1/CCC=N/C1=C/C(C)Cl.
What is the InChIKey of (5Z,6E)-6-(2-chloropropylidene)-5-ethylidene-3,4-dihydropyridine?
The InChIKey is HBVHDMKIKYJMEX-CZRQHEBESA-N. The full InChI is InChI=1S/C10H14ClN/c1-3-9-5-4-6-12-10(9)7-8(2)11/h3,6-8H,4-5H2,1-2H3/b9-3-,10-7+.
What are the key properties of (5Z,6E)-6-(2-chloropropylidene)-5-ethylidene-3,4-dihydropyridine?
(5Z,6E)-6-(2-chloropropylidene)-5-ethylidene-3,4-dihydropyridine has a molecular weight of 183.68 g/mol, XLogP of 3.31, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,6E)-6-(2-chloropropylidene)-5-ethylidene-3,4-dihydropyridine is sourced from PubChem (CID 166940445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).