C11H16N4 — CID 166940871
(2Z,4E)-3-imino-N',4-dimethyl-2-[(methylideneamino)methylidene]hepta-4,6-dienimidamide (PubChem CID 166940871) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is (2Z,4E)-3-imino-N',4-dimethyl-2-[(methylideneamino)methylidene]hepta-4,6-dienimidamide.
| Compound Name | (2Z,4E)-3-imino-N',4-dimethyl-2-[(methylideneamino)methylidene]hepta-4,6-dienimidamide |
|---|---|
| PubChem CID | 166940871 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | (2Z,4E)-3-imino-N',4-dimethyl-2-[(methylideneamino)methylidene]hepta-4,6-dienimidamide |
| SMILES | [H]/N=C(C(\C)=C\C=C)/C(=C\N=C)C(/N)=N/C |
| InChI | InChI=1S/C11H16N4/c1-5-6-8(2)10(12)9(7-14-3)11(13)15-4/h5-7,12H,1,3H2,2,4H3,(H2,13,15)/b8-6+,9-7-,12-10+ |
| InChIKey | YFKZWCGDZHBGCH-JLIPHIEMSA-N |
| XLogP | 1.71 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|