C21H27BrN2O4 — CID 166940957
(2R,3R,4R,5S)-1-[[3-[(3-bromo-5-methylanilino)methyl]phenyl]methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 166940957) has the molecular formula C21H27BrN2O4 and a molecular weight of 451.36 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[[3-[(3-bromo-5-methylanilino)methyl]phenyl]methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[[3-[(3-bromo-5-methylanilino)methyl]phenyl]methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 166940957 |
| Molecular Formula | C21H27BrN2O4 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | (2R,3R,4R,5S)-1-[[3-[(3-bromo-5-methylanilino)methyl]phenyl]methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | Cc1cc(Br)cc(NCc2cccc(CN3C[C@H](O)[C@@H](O)[C@H](O)[C@H]3CO)c2)c1 |
| InChI | InChI=1S/C21H27BrN2O4/c1-13-5-16(22)8-17(6-13)23-9-14-3-2-4-15(7-14)10-24-11-19(26)21(28)20(27)18(24)12-25/h2-8,18-21,23,25-28H,9-12H2,1H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | PNZRWCDPLPYPSG-PLACYPQZSA-N |
| XLogP | 1.63 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |