C8H7ClN4O — CID 166941626
2-chloro-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazine-7-carbaldehyde (PubChem CID 166941626) has the molecular formula C8H7ClN4O and a molecular weight of 210.62 g/mol. Its IUPAC name is 2-chloro-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazine-7-carbaldehyde.
| Compound Name | 2-chloro-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazine-7-carbaldehyde |
|---|---|
| PubChem CID | 166941626 |
| Molecular Formula | C8H7ClN4O |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 2-chloro-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazine-7-carbaldehyde |
| SMILES | CNc1nc(Cl)nn2c(C=O)ccc12 |
| InChI | InChI=1S/C8H7ClN4O/c1-10-7-6-3-2-5(4-14)13(6)12-8(9)11-7/h2-4H,1H3,(H,10,11,12) |
| InChIKey | SZICDQQTWBEFIF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|