About 1-O-tert-butyl 5-O-propan-2-yl 2-[2-(1-propan-2-yloxyethoxy)propylamino]pentanedioate
1-O-tert-butyl 5-O-propan-2-yl 2-[2-(1-propan-2-yloxyethoxy)propylamino]pentanedioate (PubChem CID 166941856) has the molecular formula C20H39NO6
and a molecular weight of 389.53 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-propan-2-yl 2-[2-(1-propan-2-yloxyethoxy)propylamino]pentanedioate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 5-O-propan-2-yl 2-[2-(1-propan-2-yloxyethoxy)propylamino]pentanedioate |
| PubChem CID | 166941856 |
| Molecular Formula | C20H39NO6 |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | 1-O-tert-butyl 5-O-propan-2-yl 2-[2-(1-propan-2-yloxyethoxy)propylamino]pentanedioate |
| SMILES | CC(C)OC(=O)CCC(NCC(C)OC(C)OC(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H39NO6/c1-13(2)24-16(6)26-15(5)12-21-17(19(23)27-20(7,8)9)10-11-18(22)25-14(3)4/h13-17,21H,10-12H2,1-9H3 |
| InChIKey | XRMPWODBGWBXJZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 5-O-propan-2-yl 2-[2-(1-propan-2-yloxyethoxy)propylamino]pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 5-O-propan-2-yl 2-[2-(1-propan-2-yloxyethoxy)propylamino]pentanedioate?
The IUPAC name of 1-O-tert-butyl 5-O-propan-2-yl 2-[2-(1-propan-2-yloxyethoxy)propylamino]pentanedioate (CID 166941856) is 1-O-tert-butyl 5-O-propan-2-yl 2-[2-(1-propan-2-yloxyethoxy)propylamino]pentanedioate.
What is the SMILES notation for 1-O-tert-butyl 5-O-propan-2-yl 2-[2-(1-propan-2-yloxyethoxy)propylamino]pentanedioate?
The canonical SMILES for 1-O-tert-butyl 5-O-propan-2-yl 2-[2-(1-propan-2-yloxyethoxy)propylamino]pentanedioate is CC(C)OC(=O)CCC(NCC(C)OC(C)OC(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of 1-O-tert-butyl 5-O-propan-2-yl 2-[2-(1-propan-2-yloxyethoxy)propylamino]pentanedioate?
The InChIKey is XRMPWODBGWBXJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39NO6/c1-13(2)24-16(6)26-15(5)12-21-17(19(23)27-20(7,8)9)10-11-18(22)25-14(3)4/h13-17,21H,10-12H2,1-9H3.
What are the key properties of 1-O-tert-butyl 5-O-propan-2-yl 2-[2-(1-propan-2-yloxyethoxy)propylamino]pentanedioate?
1-O-tert-butyl 5-O-propan-2-yl 2-[2-(1-propan-2-yloxyethoxy)propylamino]pentanedioate has a molecular weight of 389.53 g/mol, XLogP of 3.19, 12 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 5-O-propan-2-yl 2-[2-(1-propan-2-yloxyethoxy)propylamino]pentanedioate is sourced from PubChem (CID 166941856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).