C23H34N4O7 — CID 166942001
(2,5-dioxopyrrolidin-1-yl) 4-[[4-amino-4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpentanoyl]amino]-2,2,4-trimethylpentanoate (PubChem CID 166942001) has the molecular formula C23H34N4O7 and a molecular weight of 478.55 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[[4-amino-4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpentanoyl]amino]-2,2,4-trimethylpentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[[4-amino-4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpentanoyl]amino]-2,2,4-trimethylpentanoate |
|---|---|
| PubChem CID | 166942001 |
| Molecular Formula | C23H34N4O7 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[[4-amino-4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpentanoyl]amino]-2,2,4-trimethylpentanoate |
| SMILES | CC(C)(CC(C)(C)C(=O)ON1C(=O)CCC1=O)NC(=O)C(C)(C)CC(C)(N)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C23H34N4O7/c1-20(2,13-23(7,24)26-14(28)8-9-15(26)29)18(32)25-22(5,6)12-21(3,4)19(33)34-27-16(30)10-11-17(27)31/h8-9H,10-13,24H2,1-7H3,(H,25,32) |
| InChIKey | UYAQPRLZBNHOGJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 156.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|