About (E)-2-ethylimino-3,3-difluoro-N-methylhex-4-en-1-amine
(E)-2-ethylimino-3,3-difluoro-N-methylhex-4-en-1-amine (PubChem CID 166942579) has the molecular formula C9H16F2N2
and a molecular weight of 190.24 g/mol. Its IUPAC name is (E)-2-ethylimino-3,3-difluoro-N-methylhex-4-en-1-amine.
Molecular Properties
| Compound Name | (E)-2-ethylimino-3,3-difluoro-N-methylhex-4-en-1-amine |
| PubChem CID | 166942579 |
| Molecular Formula | C9H16F2N2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | (E)-2-ethylimino-3,3-difluoro-N-methylhex-4-en-1-amine |
| SMILES | C/C=C/C(F)(F)/C(CNC)=N/CC |
| InChI | InChI=1S/C9H16F2N2/c1-4-6-9(10,11)8(7-12-3)13-5-2/h4,6,12H,5,7H2,1-3H3/b6-4+,13-8+ |
| InChIKey | DFRJITOATFIVFY-HDZFOZLDSA-N |
| XLogP | 1.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-ethylimino-3,3-difluoro-N-methylhex-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-ethylimino-3,3-difluoro-N-methylhex-4-en-1-amine?
The IUPAC name of (E)-2-ethylimino-3,3-difluoro-N-methylhex-4-en-1-amine (CID 166942579) is (E)-2-ethylimino-3,3-difluoro-N-methylhex-4-en-1-amine.
What is the SMILES notation for (E)-2-ethylimino-3,3-difluoro-N-methylhex-4-en-1-amine?
The canonical SMILES for (E)-2-ethylimino-3,3-difluoro-N-methylhex-4-en-1-amine is C/C=C/C(F)(F)/C(CNC)=N/CC.
What is the InChIKey of (E)-2-ethylimino-3,3-difluoro-N-methylhex-4-en-1-amine?
The InChIKey is DFRJITOATFIVFY-HDZFOZLDSA-N. The full InChI is InChI=1S/C9H16F2N2/c1-4-6-9(10,11)8(7-12-3)13-5-2/h4,6,12H,5,7H2,1-3H3/b6-4+,13-8+.
What are the key properties of (E)-2-ethylimino-3,3-difluoro-N-methylhex-4-en-1-amine?
(E)-2-ethylimino-3,3-difluoro-N-methylhex-4-en-1-amine has a molecular weight of 190.24 g/mol, XLogP of 1.88, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-ethylimino-3,3-difluoro-N-methylhex-4-en-1-amine is sourced from PubChem (CID 166942579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).