About 2-[(Z)-3-iminoprop-1-enoxy]propane-1,1-diol
2-[(Z)-3-iminoprop-1-enoxy]propane-1,1-diol (PubChem CID 166942628) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-[(Z)-3-iminoprop-1-enoxy]propane-1,1-diol.
Molecular Properties
| Compound Name | 2-[(Z)-3-iminoprop-1-enoxy]propane-1,1-diol |
| PubChem CID | 166942628 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2-[(Z)-3-iminoprop-1-enoxy]propane-1,1-diol |
| SMILES | [H]/N=C/C=C\OC(C)C(O)O |
| InChI | InChI=1S/C6H11NO3/c1-5(6(8)9)10-4-2-3-7/h2-9H,1H3/b4-2-,7-3+ |
| InChIKey | HUTMQACWUJULIT-UFSYDLLYSA-N |
| XLogP | -0.13 |
| TPSA | 73.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-3-iminoprop-1-enoxy]propane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-3-iminoprop-1-enoxy]propane-1,1-diol?
The IUPAC name of 2-[(Z)-3-iminoprop-1-enoxy]propane-1,1-diol (CID 166942628) is 2-[(Z)-3-iminoprop-1-enoxy]propane-1,1-diol.
What is the SMILES notation for 2-[(Z)-3-iminoprop-1-enoxy]propane-1,1-diol?
The canonical SMILES for 2-[(Z)-3-iminoprop-1-enoxy]propane-1,1-diol is [H]/N=C/C=C\OC(C)C(O)O.
What is the InChIKey of 2-[(Z)-3-iminoprop-1-enoxy]propane-1,1-diol?
The InChIKey is HUTMQACWUJULIT-UFSYDLLYSA-N. The full InChI is InChI=1S/C6H11NO3/c1-5(6(8)9)10-4-2-3-7/h2-9H,1H3/b4-2-,7-3+.
What are the key properties of 2-[(Z)-3-iminoprop-1-enoxy]propane-1,1-diol?
2-[(Z)-3-iminoprop-1-enoxy]propane-1,1-diol has a molecular weight of 145.16 g/mol, XLogP of -0.13, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-3-iminoprop-1-enoxy]propane-1,1-diol is sourced from PubChem (CID 166942628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).