About 2-amino-3-(5,5-dimethylcyclopenta-1,3-dien-1-yl)propanal
2-amino-3-(5,5-dimethylcyclopenta-1,3-dien-1-yl)propanal (PubChem CID 166942699) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-amino-3-(5,5-dimethylcyclopenta-1,3-dien-1-yl)propanal.
Molecular Properties
| Compound Name | 2-amino-3-(5,5-dimethylcyclopenta-1,3-dien-1-yl)propanal |
| PubChem CID | 166942699 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2-amino-3-(5,5-dimethylcyclopenta-1,3-dien-1-yl)propanal |
| SMILES | CC1(C)C=CC=C1CC(N)C=O |
| InChI | InChI=1S/C10H15NO/c1-10(2)5-3-4-8(10)6-9(11)7-12/h3-5,7,9H,6,11H2,1-2H3 |
| InChIKey | HZNFSEXNCIVFOO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-(5,5-dimethylcyclopenta-1,3-dien-1-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(5,5-dimethylcyclopenta-1,3-dien-1-yl)propanal?
The IUPAC name of 2-amino-3-(5,5-dimethylcyclopenta-1,3-dien-1-yl)propanal (CID 166942699) is 2-amino-3-(5,5-dimethylcyclopenta-1,3-dien-1-yl)propanal.
What is the SMILES notation for 2-amino-3-(5,5-dimethylcyclopenta-1,3-dien-1-yl)propanal?
The canonical SMILES for 2-amino-3-(5,5-dimethylcyclopenta-1,3-dien-1-yl)propanal is CC1(C)C=CC=C1CC(N)C=O.
What is the InChIKey of 2-amino-3-(5,5-dimethylcyclopenta-1,3-dien-1-yl)propanal?
The InChIKey is HZNFSEXNCIVFOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-10(2)5-3-4-8(10)6-9(11)7-12/h3-5,7,9H,6,11H2,1-2H3.
What are the key properties of 2-amino-3-(5,5-dimethylcyclopenta-1,3-dien-1-yl)propanal?
2-amino-3-(5,5-dimethylcyclopenta-1,3-dien-1-yl)propanal has a molecular weight of 165.24 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(5,5-dimethylcyclopenta-1,3-dien-1-yl)propanal is sourced from PubChem (CID 166942699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).