C17H26O3 — CID 166942858
ethyl 2-[2-[(3S)-2,3-dimethylpentan-3-yl]oxyphenyl]acetate (PubChem CID 166942858) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is ethyl 2-[2-[(3S)-2,3-dimethylpentan-3-yl]oxyphenyl]acetate.
| Compound Name | ethyl 2-[2-[(3S)-2,3-dimethylpentan-3-yl]oxyphenyl]acetate |
|---|---|
| PubChem CID | 166942858 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | ethyl 2-[2-[(3S)-2,3-dimethylpentan-3-yl]oxyphenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1O[C@@](C)(CC)C(C)C |
| InChI | InChI=1S/C17H26O3/c1-6-17(5,13(3)4)20-15-11-9-8-10-14(15)12-16(18)19-7-2/h8-11,13H,6-7,12H2,1-5H3/t17-/m0/s1 |
| InChIKey | WZPKCEWVRAAGIK-KRWDZBQOSA-N |
| XLogP | 4.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |