C24H29NO4 — CID 166942888
ethyl 2-[2-[(2E,4Z)-4-[3-(aminomethyl)phenyl]-5-hydroxyhexa-2,4-dien-2-yl]oxy-6-methylphenyl]acetate (PubChem CID 166942888) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is ethyl 2-[2-[(2E,4Z)-4-[3-(aminomethyl)phenyl]-5-hydroxyhexa-2,4-dien-2-yl]oxy-6-methylphenyl]acetate.
| Compound Name | ethyl 2-[2-[(2E,4Z)-4-[3-(aminomethyl)phenyl]-5-hydroxyhexa-2,4-dien-2-yl]oxy-6-methylphenyl]acetate |
|---|---|
| PubChem CID | 166942888 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | ethyl 2-[2-[(2E,4Z)-4-[3-(aminomethyl)phenyl]-5-hydroxyhexa-2,4-dien-2-yl]oxy-6-methylphenyl]acetate |
| SMILES | CCOC(=O)Cc1c(C)cccc1O/C(C)=C/C(=C(\C)O)c1cccc(CN)c1 |
| InChI | InChI=1S/C24H29NO4/c1-5-28-24(27)14-21-16(2)8-6-11-23(21)29-17(3)12-22(18(4)26)20-10-7-9-19(13-20)15-25/h6-13,26H,5,14-15,25H2,1-4H3/b17-12+,22-18- |
| InChIKey | VWMIEGICSJSDIN-PKWTXYRRSA-N |
| XLogP | 4.83 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|