C22H31NO4 — CID 166942965
tert-butyl N-[[3-[(2Z,4Z)-2-hydroxy-6-prop-1-en-2-yloxyhepta-2,4-dien-3-yl]phenyl]methyl]carbamate (PubChem CID 166942965) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is tert-butyl N-[[3-[(2Z,4Z)-2-hydroxy-6-prop-1-en-2-yloxyhepta-2,4-dien-3-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[(2Z,4Z)-2-hydroxy-6-prop-1-en-2-yloxyhepta-2,4-dien-3-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 166942965 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | tert-butyl N-[[3-[(2Z,4Z)-2-hydroxy-6-prop-1-en-2-yloxyhepta-2,4-dien-3-yl]phenyl]methyl]carbamate |
| SMILES | C=C(C)OC(C)/C=C\C(=C(/C)O)c1cccc(CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H31NO4/c1-15(2)26-16(3)11-12-20(17(4)24)19-10-8-9-18(13-19)14-23-21(25)27-22(5,6)7/h8-13,16,24H,1,14H2,2-7H3,(H,23,25)/b12-11-,20-17- |
| InChIKey | HYPHKQKVICWALV-KFWAKDTGSA-N |
| XLogP | 5.50 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|